C20H9FO8 — CID 154634330
6-(3-fluorophenyl)-2,8-dioxopyrano[2,3-f]chromene-3,9-dicarboxylic acid (PubChem CID 154634330) has the molecular formula C20H9FO8 and a molecular weight of 396.28 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-2,8-dioxopyrano[2,3-f]chromene-3,9-dicarboxylic acid.
| Compound Name | 6-(3-fluorophenyl)-2,8-dioxopyrano[2,3-f]chromene-3,9-dicarboxylic acid |
|---|---|
| PubChem CID | 154634330 |
| Molecular Formula | C20H9FO8 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 6-(3-fluorophenyl)-2,8-dioxopyrano[2,3-f]chromene-3,9-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(oc1=O)c(-c1cccc(F)c1)cc1cc(C(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C20H9FO8/c21-10-3-1-2-8(4-10)11-5-9-6-13(17(22)23)19(26)28-15(9)12-7-14(18(24)25)20(27)29-16(11)12/h1-7H,(H,22,23)(H,24,25) |
| InChIKey | ZRPABDXNNFWTFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|