C21H12O9 — CID 154634335
10-(3-methoxyphenyl)-2,8-dioxopyrano[3,2-g]chromene-3,7-dicarboxylic acid (PubChem CID 154634335) has the molecular formula C21H12O9 and a molecular weight of 408.32 g/mol. Its IUPAC name is 10-(3-methoxyphenyl)-2,8-dioxopyrano[3,2-g]chromene-3,7-dicarboxylic acid.
| Compound Name | 10-(3-methoxyphenyl)-2,8-dioxopyrano[3,2-g]chromene-3,7-dicarboxylic acid |
|---|---|
| PubChem CID | 154634335 |
| Molecular Formula | C21H12O9 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 10-(3-methoxyphenyl)-2,8-dioxopyrano[3,2-g]chromene-3,7-dicarboxylic acid |
| SMILES | COc1cccc(-c2c3oc(=O)c(C(=O)O)cc3cc3cc(C(=O)O)c(=O)oc23)c1 |
| InChI | InChI=1S/C21H12O9/c1-28-12-4-2-3-9(6-12)15-16-10(7-13(18(22)23)20(26)29-16)5-11-8-14(19(24)25)21(27)30-17(11)15/h2-8H,1H3,(H,22,23)(H,24,25) |
| InChIKey | PCGUVDQXYAPRJC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|