About 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine
4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine (PubChem CID 154634760) has the molecular formula C20H10F6N2S
and a molecular weight of 424.37 g/mol. Its IUPAC name is 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
| PubChem CID | 154634760 |
| Molecular Formula | C20H10F6N2S |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
| SMILES | FC(F)(F)c1cccc(-c2nnc(-c3cccc(C(F)(F)F)c3)c3sccc23)c1 |
| InChI | InChI=1S/C20H10F6N2S/c21-19(22,23)13-5-1-3-11(9-13)16-15-7-8-29-18(15)17(28-27-16)12-4-2-6-14(10-12)20(24,25)26/h1-10H |
| InChIKey | QVYWCNXMWKPGFD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The IUPAC name of 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine (CID 154634760) is 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine.
What is the SMILES notation for 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The canonical SMILES for 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine is FC(F)(F)c1cccc(-c2nnc(-c3cccc(C(F)(F)F)c3)c3sccc23)c1.
What is the InChIKey of 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The InChIKey is QVYWCNXMWKPGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10F6N2S/c21-19(22,23)13-5-1-3-11(9-13)16-15-7-8-29-18(15)17(28-27-16)12-4-2-6-14(10-12)20(24,25)26/h1-10H.
What are the key properties of 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine has a molecular weight of 424.37 g/mol, XLogP of 7.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine is sourced from PubChem (CID 154634760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).