C22H8F12N2S — CID 154634761
4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine (PubChem CID 154634761) has the molecular formula C22H8F12N2S and a molecular weight of 560.36 g/mol. Its IUPAC name is 4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine.
| Compound Name | 4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
|---|---|
| PubChem CID | 154634761 |
| Molecular Formula | C22H8F12N2S |
| Molecular Weight | 560.36 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | 4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
| SMILES | FC(F)(F)c1cc(-c2nnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3sccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H8F12N2S/c23-19(24,25)11-3-9(4-12(7-11)20(26,27)28)16-15-1-2-37-18(15)17(36-35-16)10-5-13(21(29,30)31)8-14(6-10)22(32,33)34/h1-8H |
| InChIKey | FNHZHYYQGHXAAY-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.36 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |