C30H39FN2O3 — CID 154635126
(E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-3-methylpent-2-enamide (PubChem CID 154635126) has the molecular formula C30H39FN2O3 and a molecular weight of 494.65 g/mol. Its IUPAC name is (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-3-methylpent-2-enamide.
| Compound Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-3-methylpent-2-enamide |
|---|---|
| PubChem CID | 154635126 |
| Molecular Formula | C30H39FN2O3 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-3-methylpent-2-enamide |
| SMILES | C=C1CC[C@@H]2C(C)(C)[C@H](O)CC[C@@]2(C)[C@@H]1CC/C(C)=C/C(=O)NCc1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C30H39FN2O3/c1-19(6-12-24-20(2)7-13-26-29(3,4)27(34)14-15-30(24,26)5)16-28(35)32-18-23-17-25(33-36-23)21-8-10-22(31)11-9-21/h8-11,16-17,24,26-27,34H,2,6-7,12-15,18H2,1,3-5H3,(H,32,35)/b19-16+/t24-,26-,27-,30+/m1/s1 |
| InChIKey | KXGOZSGLMUIKGE-VWFLPPRNSA-N |
| XLogP | 6.59 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|