C13H12N2O7 — CID 154635231
6-(dimethylamino)-1-hydroxy-4,11,15-trioxa-7-azatricyclo[7.3.3.05,10]pentadeca-5(10),6,8-triene-3,12,14-trione (PubChem CID 154635231) has the molecular formula C13H12N2O7 and a molecular weight of 308.25 g/mol. Its IUPAC name is 6-(dimethylamino)-1-hydroxy-4,11,15-trioxa-7-azatricyclo[7.3.3.05,10]pentadeca-5(10),6,8-triene-3,12,14-trione.
| Compound Name | 6-(dimethylamino)-1-hydroxy-4,11,15-trioxa-7-azatricyclo[7.3.3.05,10]pentadeca-5(10),6,8-triene-3,12,14-trione |
|---|---|
| PubChem CID | 154635231 |
| Molecular Formula | C13H12N2O7 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-(dimethylamino)-1-hydroxy-4,11,15-trioxa-7-azatricyclo[7.3.3.05,10]pentadeca-5(10),6,8-triene-3,12,14-trione |
| SMILES | CN(C)c1ncc2c3c1OC(=O)CC(O)(CC(=O)O2)C(=O)O3 |
| InChI | InChI=1S/C13H12N2O7/c1-15(2)11-10-9-6(5-14-11)20-7(16)3-13(19,12(18)22-9)4-8(17)21-10/h5,19H,3-4H2,1-2H3 |
| InChIKey | BLTRGRKCLYKECM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |