About 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine
1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine (PubChem CID 154635268) has the molecular formula C17H19N3S
and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine.
Molecular Properties
| Compound Name | 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine |
| PubChem CID | 154635268 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine |
| SMILES | Cc1nccc2c1[nH]c1ccc(NC3CCSCC3)cc12 |
| InChI | InChI=1S/C17H19N3S/c1-11-17-14(4-7-18-11)15-10-13(2-3-16(15)20-17)19-12-5-8-21-9-6-12/h2-4,7,10,12,19-20H,5-6,8-9H2,1H3 |
| InChIKey | JAUOFDPKDPDZTL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine?
The IUPAC name of 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine (CID 154635268) is 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine.
What is the SMILES notation for 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine?
The canonical SMILES for 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine is Cc1nccc2c1[nH]c1ccc(NC3CCSCC3)cc12.
What is the InChIKey of 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine?
The InChIKey is JAUOFDPKDPDZTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3S/c1-11-17-14(4-7-18-11)15-10-13(2-3-16(15)20-17)19-12-5-8-21-9-6-12/h2-4,7,10,12,19-20H,5-6,8-9H2,1H3.
What are the key properties of 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine?
1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine has a molecular weight of 297.43 g/mol, XLogP of 4.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(thian-4-yl)-9H-pyrido[3,4-b]indol-6-amine is sourced from PubChem (CID 154635268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).