C20H25F5N4O6S — CID 15463679
(2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-[3-(3-piperidin-4-ylpropanoylamino)propanoylamino]propanoic acid (PubChem CID 15463679) has the molecular formula C20H25F5N4O6S and a molecular weight of 544.50 g/mol. Its IUPAC name is (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-[3-(3-piperidin-4-ylpropanoylamino)propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-[3-(3-piperidin-4-ylpropanoylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 15463679 |
| Molecular Formula | C20H25F5N4O6S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-3-[3-(3-piperidin-4-ylpropanoylamino)propanoylamino]propanoic acid |
| SMILES | O=C(CCC1CCNCC1)NCCC(=O)NC[C@H](NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C20H25F5N4O6S/c21-14-15(22)17(24)19(18(25)16(14)23)36(34,35)29-11(20(32)33)9-28-13(31)5-8-27-12(30)2-1-10-3-6-26-7-4-10/h10-11,26,29H,1-9H2,(H,27,30)(H,28,31)(H,32,33)/t11-/m0/s1 |
| InChIKey | RSMGISWVZFEMLJ-NSHDSACASA-N |
| XLogP | 0.52 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|