About 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide
4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide (PubChem CID 154636919) has the molecular formula C24H35N3O2
and a molecular weight of 397.56 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide.
Molecular Properties
| Compound Name | 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide |
| PubChem CID | 154636919 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(NC(=O)NC23CC4CC(C)(CC(C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H35N3O2/c1-16(2)12-25-20(28)18-5-7-19(8-6-18)26-21(29)27-24-11-17-9-22(3,14-24)13-23(4,10-17)15-24/h5-8,16-17H,9-15H2,1-4H3,(H,25,28)(H2,26,27,29) |
| InChIKey | GMWZZCSAOCEZCL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide?
The IUPAC name of 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide (CID 154636919) is 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide.
What is the SMILES notation for 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide?
The canonical SMILES for 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide is CC(C)CNC(=O)c1ccc(NC(=O)NC23CC4CC(C)(CC(C)(C4)C2)C3)cc1.
What is the InChIKey of 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide?
The InChIKey is GMWZZCSAOCEZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35N3O2/c1-16(2)12-25-20(28)18-5-7-19(8-6-18)26-21(29)27-24-11-17-9-22(3,14-24)13-23(4,10-17)15-24/h5-8,16-17H,9-15H2,1-4H3,(H,25,28)(H2,26,27,29).
What are the key properties of 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide?
4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide has a molecular weight of 397.56 g/mol, XLogP of 4.94, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-(2-methylpropyl)benzamide is sourced from PubChem (CID 154636919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).