About 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride
2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride (PubChem CID 154637483) has the molecular formula C12H16ClFN4O
and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride |
| PubChem CID | 154637483 |
| Molecular Formula | C12H16ClFN4O |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride |
| SMILES | CCn1ccc2nn(C/C(=C/F)CN)cc2c1=O.Cl |
| InChI | InChI=1S/C12H15FN4O.ClH/c1-2-16-4-3-11-10(12(16)18)8-17(15-11)7-9(5-13)6-14;/h3-5,8H,2,6-7,14H2,1H3;1H/b9-5+; |
| InChIKey | NZMBEPIMKRRTGY-SZKNIZGXSA-N |
| XLogP | 1.45 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride?
The IUPAC name of 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride (CID 154637483) is 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride.
What is the SMILES notation for 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride?
The canonical SMILES for 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride is CCn1ccc2nn(C/C(=C/F)CN)cc2c1=O.Cl.
What is the InChIKey of 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride?
The InChIKey is NZMBEPIMKRRTGY-SZKNIZGXSA-N. The full InChI is InChI=1S/C12H15FN4O.ClH/c1-2-16-4-3-11-10(12(16)18)8-17(15-11)7-9(5-13)6-14;/h3-5,8H,2,6-7,14H2,1H3;1H/b9-5+;.
What are the key properties of 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride?
2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride has a molecular weight of 286.74 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]-5-ethylpyrazolo[4,3-c]pyridin-4-one;hydrochloride is sourced from PubChem (CID 154637483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).