About 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one
5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one (PubChem CID 154637525) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one |
| PubChem CID | 154637525 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one |
| SMILES | CCn1ccc2[nH]ncc2c1=O |
| InChI | InChI=1S/C8H9N3O/c1-2-11-4-3-7-6(8(11)12)5-9-10-7/h3-5H,2H2,1H3,(H,9,10) |
| InChIKey | UYKGXXMMYKUCDI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one?
The IUPAC name of 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one (CID 154637525) is 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one.
What is the SMILES notation for 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one?
The canonical SMILES for 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one is CCn1ccc2[nH]ncc2c1=O.
What is the InChIKey of 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one?
The InChIKey is UYKGXXMMYKUCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-2-11-4-3-7-6(8(11)12)5-9-10-7/h3-5H,2H2,1H3,(H,9,10).
What are the key properties of 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one?
5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one has a molecular weight of 163.18 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1H-pyrazolo[4,5-c]pyridin-4-one is sourced from PubChem (CID 154637525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).