C21H21F3N4OS — CID 154638402
N-(2-cyanocyclopentyl)-2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetamide (PubChem CID 154638402) has the molecular formula C21H21F3N4OS and a molecular weight of 434.49 g/mol. Its IUPAC name is N-(2-cyanocyclopentyl)-2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetamide.
| Compound Name | N-(2-cyanocyclopentyl)-2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 154638402 |
| Molecular Formula | C21H21F3N4OS |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-(2-cyanocyclopentyl)-2-[(6R)-2-methyl-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]acetamide |
| SMILES | Cn1c(CC(=O)NC2CCCC2C#N)c2n(c1=S)C[C@@H](c1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C21H21F3N4OS/c1-27-16(8-18(29)26-15-4-2-3-11(15)9-25)17-7-12(10-28(17)21(27)30)19-13(22)5-6-14(23)20(19)24/h5-6,11-12,15H,2-4,7-8,10H2,1H3,(H,26,29)/t11?,12-,15?/m0/s1 |
| InChIKey | YWSDIDYKAAMTBZ-AVERBVTBSA-N |
| XLogP | 3.66 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|