C25H28ClN5O — CID 154638644
8-chloro-N,N-dimethyl-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine (PubChem CID 154638644) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is 8-chloro-N,N-dimethyl-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine.
| Compound Name | 8-chloro-N,N-dimethyl-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine |
|---|---|
| PubChem CID | 154638644 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 8-chloro-N,N-dimethyl-1-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepin-5-amine |
| SMILES | CN(C)C1Cc2cc(Cl)ccc2-n2c(nnc2N2CCC3(CC2)OCc2ccccc23)C1 |
| InChI | InChI=1S/C25H28ClN5O/c1-29(2)20-14-18-13-19(26)7-8-22(18)31-23(15-20)27-28-24(31)30-11-9-25(10-12-30)21-6-4-3-5-17(21)16-32-25/h3-8,13,20H,9-12,14-16H2,1-2H3 |
| InChIKey | CJYAZXOQOZQOSL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |