About 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile
3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile (PubChem CID 154639804) has the molecular formula C17H16F3NO2
and a molecular weight of 323.31 g/mol. Its IUPAC name is 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile.
Molecular Properties
| Compound Name | 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile |
| PubChem CID | 154639804 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile |
| SMILES | COC1(c2ccccc2C(F)(F)F)C=C(C#N)C(=O)C(C)(C)C1 |
| InChI | InChI=1S/C17H16F3NO2/c1-15(2)10-16(23-3,8-11(9-21)14(15)22)12-6-4-5-7-13(12)17(18,19)20/h4-8H,10H2,1-3H3 |
| InChIKey | LCATZXOAYSERAI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile?
The IUPAC name of 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile (CID 154639804) is 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile.
What is the SMILES notation for 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile?
The canonical SMILES for 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile is COC1(c2ccccc2C(F)(F)F)C=C(C#N)C(=O)C(C)(C)C1.
What is the InChIKey of 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile?
The InChIKey is LCATZXOAYSERAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3NO2/c1-15(2)10-16(23-3,8-11(9-21)14(15)22)12-6-4-5-7-13(12)17(18,19)20/h4-8H,10H2,1-3H3.
What are the key properties of 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile?
3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile has a molecular weight of 323.31 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,5-dimethyl-6-oxo-3-[2-(trifluoromethyl)phenyl]cyclohexene-1-carbonitrile is sourced from PubChem (CID 154639804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).