C11H17Cl3N4 — CID 154639878
(3aS,6aS)-2-(6-chloropyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine;dihydrochloride (PubChem CID 154639878) has the molecular formula C11H17Cl3N4 and a molecular weight of 311.64 g/mol. Its IUPAC name is (3aS,6aS)-2-(6-chloropyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine;dihydrochloride.
| Compound Name | (3aS,6aS)-2-(6-chloropyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 154639878 |
| Molecular Formula | C11H17Cl3N4 |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (3aS,6aS)-2-(6-chloropyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1C[C@@H]2CN(c3ccc(Cl)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C11H15ClN4.2ClH/c12-10-1-2-11(15-14-10)16-5-7-3-9(13)4-8(7)6-16;;/h1-2,7-9H,3-6,13H2;2*1H/t7-,8-;;/m1../s1 |
| InChIKey | YQPOMNLPHAOVNM-RHJRFJOKSA-N |
| XLogP | 2.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |