About 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione
6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione (PubChem CID 154640872) has the molecular formula C9H6F3NO2
and a molecular weight of 217.15 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione |
| PubChem CID | 154640872 |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione |
| SMILES | O=C1NC2=CC(C(F)(F)F)=CCC2C1=O |
| InChI | InChI=1S/C9H6F3NO2/c10-9(11,12)4-1-2-5-6(3-4)13-8(15)7(5)14/h1,3,5H,2H2,(H,13,15) |
| InChIKey | DCXRNQMXJMFEBM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione?
The IUPAC name of 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione (CID 154640872) is 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione.
What is the SMILES notation for 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione?
The canonical SMILES for 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione is O=C1NC2=CC(C(F)(F)F)=CCC2C1=O.
What is the InChIKey of 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione?
The InChIKey is DCXRNQMXJMFEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3NO2/c10-9(11,12)4-1-2-5-6(3-4)13-8(15)7(5)14/h1,3,5H,2H2,(H,13,15).
What are the key properties of 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione?
6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione has a molecular weight of 217.15 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3a,4-dihydro-1H-indole-2,3-dione is sourced from PubChem (CID 154640872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).