C32H46Br2N4O8 — CID 154642204
tert-butyl N-(2-bromo-4-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 154642204) has the molecular formula C32H46Br2N4O8 and a molecular weight of 774.55 g/mol. Its IUPAC name is tert-butyl N-(2-bromo-4-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(2-bromo-4-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 154642204 |
| Molecular Formula | C32H46Br2N4O8 |
| Molecular Weight | 774.55 g/mol |
| Exact Mass | 772.17 |
| IUPAC Name | tert-butyl N-(2-bromo-4-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | Cc1ccnc(Br)c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.Cc1ccnc(Br)c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C16H23BrN2O4/c2*1-10-8-9-18-12(17)11(10)19(13(20)22-15(2,3)4)14(21)23-16(5,6)7/h2*8-9H,1-7H3 |
| InChIKey | QXINWTNEUDHBBE-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.55 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|