C22H22ClFN4O4 — CID 154642282
propan-2-yl 2-chloro-5-fluoro-6-[5-oxo-3-(phenylmethoxymethyl)-4-prop-2-enyl-1,2,4-triazol-1-yl]pyridine-3-carboxylate (PubChem CID 154642282) has the molecular formula C22H22ClFN4O4 and a molecular weight of 460.89 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-fluoro-6-[5-oxo-3-(phenylmethoxymethyl)-4-prop-2-enyl-1,2,4-triazol-1-yl]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-chloro-5-fluoro-6-[5-oxo-3-(phenylmethoxymethyl)-4-prop-2-enyl-1,2,4-triazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 154642282 |
| Molecular Formula | C22H22ClFN4O4 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | propan-2-yl 2-chloro-5-fluoro-6-[5-oxo-3-(phenylmethoxymethyl)-4-prop-2-enyl-1,2,4-triazol-1-yl]pyridine-3-carboxylate |
| SMILES | C=CCn1c(COCc2ccccc2)nn(-c2nc(Cl)c(C(=O)OC(C)C)cc2F)c1=O |
| InChI | InChI=1S/C22H22ClFN4O4/c1-4-10-27-18(13-31-12-15-8-6-5-7-9-15)26-28(22(27)30)20-17(24)11-16(19(23)25-20)21(29)32-14(2)3/h4-9,11,14H,1,10,12-13H2,2-3H3 |
| InChIKey | MGPLEPABZLTIHX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|