C17H16F4N6O4S — CID 154642312
6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-N-(1,2-thiazol-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide (PubChem CID 154642312) has the molecular formula C17H16F4N6O4S and a molecular weight of 476.41 g/mol. Its IUPAC name is 6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-N-(1,2-thiazol-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide.
| Compound Name | 6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-N-(1,2-thiazol-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 154642312 |
| Molecular Formula | C17H16F4N6O4S |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-N-(1,2-thiazol-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine-3-carboxamide |
| SMILES | CCn1c(CO)nn(-c2nc(O[C@@H](C)C(F)(F)F)c(C(=O)Nc3cnsc3)cc2F)c1=O |
| InChI | InChI=1S/C17H16F4N6O4S/c1-3-26-12(6-28)25-27(16(26)30)13-11(18)4-10(14(29)23-9-5-22-32-7-9)15(24-13)31-8(2)17(19,20)21/h4-5,7-8,28H,3,6H2,1-2H3,(H,23,29)/t8-/m0/s1 |
| InChIKey | BSKSFAQTXKBYFB-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |