C4H3F8NO2S — CID 154642826
1,1,1-trifluoro-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide (PubChem CID 154642826) has the molecular formula C4H3F8NO2S and a molecular weight of 281.12 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide |
|---|---|
| PubChem CID | 154642826 |
| Molecular Formula | C4H3F8NO2S |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 1,1,1-trifluoro-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H3F8NO2S/c5-2(6,3(7,8)9)1-13-16(14,15)4(10,11)12/h13H,1H2 |
| InChIKey | JALGROFGNPUBEG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|