About 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea
3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea (PubChem CID 154642831) has the molecular formula C14H31N3O
and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea |
| PubChem CID | 154642831 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)NCCCCCCCN)C(C)C |
| InChI | InChI=1S/C14H31N3O/c1-12(2)17(13(3)4)14(18)16-11-9-7-5-6-8-10-15/h12-13H,5-11,15H2,1-4H3,(H,16,18) |
| InChIKey | OLGZLBMXSLQQNS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea?
The IUPAC name of 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea (CID 154642831) is 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea.
What is the SMILES notation for 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea?
The canonical SMILES for 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea is CC(C)N(C(=O)NCCCCCCCN)C(C)C.
What is the InChIKey of 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea?
The InChIKey is OLGZLBMXSLQQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N3O/c1-12(2)17(13(3)4)14(18)16-11-9-7-5-6-8-10-15/h12-13H,5-11,15H2,1-4H3,(H,16,18).
What are the key properties of 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea?
3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea has a molecular weight of 257.42 g/mol, XLogP of 2.72, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-aminoheptyl)-1,1-di(propan-2-yl)urea is sourced from PubChem (CID 154642831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).