C11H29N3O2 — CID 154643081
2-amino-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]hexanamide;molecular hydrogen (PubChem CID 154643081) has the molecular formula C11H29N3O2 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-amino-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]hexanamide;molecular hydrogen.
| Compound Name | 2-amino-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]hexanamide;molecular hydrogen |
|---|---|
| PubChem CID | 154643081 |
| Molecular Formula | C11H29N3O2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2-amino-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]hexanamide;molecular hydrogen |
| SMILES | CCCCC(N)C(=O)N[C@H](C(N)=O)C(C)C.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C11H23N3O2.3H2/c1-4-5-6-8(12)11(16)14-9(7(2)3)10(13)15;;;/h7-9H,4-6,12H2,1-3H3,(H2,13,15)(H,14,16);3*1H/t8?,9-;;;/m0.../s1 |
| InChIKey | AISVZYZXMLPYQI-VBWSOLROSA-N |
| XLogP | 0.87 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |