C28H31FN2O2 — CID 154643161
(E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol (PubChem CID 154643161) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol.
| Compound Name | (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol |
|---|---|
| PubChem CID | 154643161 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (E,3R)-1-(3-fluoro-4-phenylmethoxyphenyl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol |
| SMILES | O[C@@H](/C=C/c1ccc(OCc2ccccc2)c(F)c1)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C28H31FN2O2/c29-26-19-21(13-17-27(26)33-20-22-7-2-1-3-8-22)12-16-25(32)11-5-4-10-24-15-14-23-9-6-18-30-28(23)31-24/h1-3,7-8,12-17,19,25,32H,4-6,9-11,18,20H2,(H,30,31)/b16-12+/t25-/m1/s1 |
| InChIKey | CZNYHQPLSWAPAO-IMYWFDTISA-N |
| XLogP | 5.94 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|