C24H31FN2O3 — CID 154643164
methyl (3S)-3-(3-fluoro-4-hydroxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 154643164) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is methyl (3S)-3-(3-fluoro-4-hydroxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | methyl (3S)-3-(3-fluoro-4-hydroxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 154643164 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | methyl (3S)-3-(3-fluoro-4-hydroxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | COC(=O)C[C@H](CCCCCCc1ccc2c(n1)NCCC2)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C24H31FN2O3/c1-30-23(29)16-18(19-11-13-22(28)21(25)15-19)7-4-2-3-5-9-20-12-10-17-8-6-14-26-24(17)27-20/h10-13,15,18,28H,2-9,14,16H2,1H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | HQDYDONTFQUPHV-SFHVURJKSA-N |
| XLogP | 5.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|