C32H39N3O4 — CID 154643207
tert-butyl 7-[7-oxo-7-(6-phenylmethoxy-3-pyridinyl)heptyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 154643207) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is tert-butyl 7-[7-oxo-7-(6-phenylmethoxy-3-pyridinyl)heptyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[7-oxo-7-(6-phenylmethoxy-3-pyridinyl)heptyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 154643207 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | tert-butyl 7-[7-oxo-7-(6-phenylmethoxy-3-pyridinyl)heptyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCCCCCC(=O)c3ccc(OCc4ccccc4)nc3)nc21 |
| InChI | InChI=1S/C32H39N3O4/c1-32(2,3)39-31(37)35-21-11-14-25-17-19-27(34-30(25)35)15-9-4-5-10-16-28(36)26-18-20-29(33-22-26)38-23-24-12-7-6-8-13-24/h6-8,12-13,17-20,22H,4-5,9-11,14-16,21,23H2,1-3H3 |
| InChIKey | PCKZURAGFPWWLV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|