C36H45N3O5 — CID 154643237
tert-butyl 7-[(Z)-9-ethoxy-9-oxo-7-(6-phenylmethoxy-3-pyridinyl)non-7-enyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 154643237) has the molecular formula C36H45N3O5 and a molecular weight of 599.77 g/mol. Its IUPAC name is tert-butyl 7-[(Z)-9-ethoxy-9-oxo-7-(6-phenylmethoxy-3-pyridinyl)non-7-enyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[(Z)-9-ethoxy-9-oxo-7-(6-phenylmethoxy-3-pyridinyl)non-7-enyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 154643237 |
| Molecular Formula | C36H45N3O5 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | tert-butyl 7-[(Z)-9-ethoxy-9-oxo-7-(6-phenylmethoxy-3-pyridinyl)non-7-enyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)/C=C(/CCCCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2)c1ccc(OCc2ccccc2)nc1 |
| InChI | InChI=1S/C36H45N3O5/c1-5-42-33(40)24-29(30-20-22-32(37-25-30)43-26-27-14-9-8-10-15-27)16-11-6-7-12-18-31-21-19-28-17-13-23-39(34(28)38-31)35(41)44-36(2,3)4/h8-10,14-15,19-22,24-25H,5-7,11-13,16-18,23,26H2,1-4H3/b29-24- |
| InChIKey | WTMRDSKMEUTTSR-OLFWJLLRSA-N |
| XLogP | 7.88 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|