About ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate
ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate (PubChem CID 154643546) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate.
Molecular Properties
| Compound Name | ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate |
| PubChem CID | 154643546 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate |
| SMILES | C=C(/C=C\C(=C)NC)COC(C)=O.CC |
| InChI | InChI=1S/C10H15NO2.C2H6/c1-8(7-13-10(3)12)5-6-9(2)11-4;1-2/h5-6,11H,1-2,7H2,3-4H3;1-2H3/b6-5-; |
| InChIKey | XBDHCZJWRDIKQO-YSMBQZINSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate?
The IUPAC name of ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate (CID 154643546) is ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate.
What is the SMILES notation for ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate?
The canonical SMILES for ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate is C=C(/C=C\C(=C)NC)COC(C)=O.CC.
What is the InChIKey of ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate?
The InChIKey is XBDHCZJWRDIKQO-YSMBQZINSA-N. The full InChI is InChI=1S/C10H15NO2.C2H6/c1-8(7-13-10(3)12)5-6-9(2)11-4;1-2/h5-6,11H,1-2,7H2,3-4H3;1-2H3/b6-5-;.
What are the key properties of ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate?
ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate has a molecular weight of 211.30 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienyl] acetate is sourced from PubChem (CID 154643546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).