About 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine
6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine (PubChem CID 154643703) has the molecular formula C19H39N3O
and a molecular weight of 325.54 g/mol. Its IUPAC name is 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine |
| PubChem CID | 154643703 |
| Molecular Formula | C19H39N3O |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine |
| SMILES | C=C(CCCC(=C)NCCOCCNC)NCCCCC(C)C |
| InChI | InChI=1S/C19H39N3O/c1-17(2)9-6-7-12-21-18(3)10-8-11-19(4)22-14-16-23-15-13-20-5/h17,20-22H,3-4,6-16H2,1-2,5H3 |
| InChIKey | JPVRVBSDLIJXDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine?
The IUPAC name of 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine (CID 154643703) is 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine.
What is the SMILES notation for 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine?
The canonical SMILES for 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine is C=C(CCCC(=C)NCCOCCNC)NCCCCC(C)C.
What is the InChIKey of 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine?
The InChIKey is JPVRVBSDLIJXDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39N3O/c1-17(2)9-6-7-12-21-18(3)10-8-11-19(4)22-14-16-23-15-13-20-5/h17,20-22H,3-4,6-16H2,1-2,5H3.
What are the key properties of 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine?
6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine has a molecular weight of 325.54 g/mol, XLogP of 3.43, 17 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-[2-[2-(methylamino)ethoxy]ethyl]-2-N-(5-methylhexyl)hepta-1,6-diene-2,6-diamine is sourced from PubChem (CID 154643703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).