C17H19ClFN5O2 — CID 154644018
tert-butyl 6-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 154644018) has the molecular formula C17H19ClFN5O2 and a molecular weight of 379.82 g/mol. Its IUPAC name is tert-butyl 6-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 154644018 |
| Molecular Formula | C17H19ClFN5O2 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | tert-butyl 6-(7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(c1ncnc3c(F)c(Cl)ncc13)C2 |
| InChI | InChI=1S/C17H19ClFN5O2/c1-16(2,3)26-15(25)24-7-17(8-24)5-23(6-17)14-10-4-20-13(18)11(19)12(10)21-9-22-14/h4,9H,5-8H2,1-3H3 |
| InChIKey | OCIKCFCNCVPASD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|