C13H15ClFN5S — CID 154644309
7-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrido[4,3-d]pyrimidine (PubChem CID 154644309) has the molecular formula C13H15ClFN5S and a molecular weight of 327.82 g/mol. Its IUPAC name is 7-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 154644309 |
| Molecular Formula | C13H15ClFN5S |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 7-chloro-8-fluoro-4-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| SMILES | CSc1nc(N2CCN(C)CC2)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C13H15ClFN5S/c1-19-3-5-20(6-4-19)12-8-7-16-11(14)9(15)10(8)17-13(18-12)21-2/h7H,3-6H2,1-2H3 |
| InChIKey | YUIPGSLTSLZZNJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|