C23H23F2N7O2 — CID 154644456
2-fluoro-1-[4-[8-fluoro-7-[3-methanimidoyl-2-(methylamino)phenyl]-2-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 154644456) has the molecular formula C23H23F2N7O2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-fluoro-1-[4-[8-fluoro-7-[3-methanimidoyl-2-(methylamino)phenyl]-2-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 2-fluoro-1-[4-[8-fluoro-7-[3-methanimidoyl-2-(methylamino)phenyl]-2-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154644456 |
| Molecular Formula | C23H23F2N7O2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-fluoro-1-[4-[8-fluoro-7-[3-methanimidoyl-2-(methylamino)phenyl]-2-methoxypyrido[4,3-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1cccc(-c2ncc3c(N4CCN(C(=O)C(=C)F)CC4)nc(OC)nc3c2F)c1NC |
| InChI | InChI=1S/C23H23F2N7O2/c1-13(24)22(33)32-9-7-31(8-10-32)21-16-12-28-19(17(25)20(16)29-23(30-21)34-3)15-6-4-5-14(11-26)18(15)27-2/h4-6,11-12,26-27H,1,7-10H2,2-3H3/b26-11+ |
| InChIKey | CGORXPKJVOPRRE-KBKYJPHKSA-N |
| XLogP | 3.01 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|