C21H12F7N3O5 — CID 154644936
4-[[2,3,4-trifluoro-6-[3-fluoro-2-methoxy-4-(trifluoromethoxy)phenoxy]benzoyl]amino]pyridine-2-carboxamide (PubChem CID 154644936) has the molecular formula C21H12F7N3O5 and a molecular weight of 519.33 g/mol. Its IUPAC name is 4-[[2,3,4-trifluoro-6-[3-fluoro-2-methoxy-4-(trifluoromethoxy)phenoxy]benzoyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[2,3,4-trifluoro-6-[3-fluoro-2-methoxy-4-(trifluoromethoxy)phenoxy]benzoyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154644936 |
| Molecular Formula | C21H12F7N3O5 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 4-[[2,3,4-trifluoro-6-[3-fluoro-2-methoxy-4-(trifluoromethoxy)phenoxy]benzoyl]amino]pyridine-2-carboxamide |
| SMILES | COc1c(Oc2cc(F)c(F)c(F)c2C(=O)Nc2ccnc(C(N)=O)c2)ccc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C21H12F7N3O5/c1-34-18-12(3-2-11(16(18)24)36-21(26,27)28)35-13-7-9(22)15(23)17(25)14(13)20(33)31-8-4-5-30-10(6-8)19(29)32/h2-7H,1H3,(H2,29,32)(H,30,31,33) |
| InChIKey | LKYWOBUUVJCLGC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|