About 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid
3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid (PubChem CID 154645221) has the molecular formula C17H13F3O5
and a molecular weight of 354.28 g/mol. Its IUPAC name is 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid |
| PubChem CID | 154645221 |
| Molecular Formula | C17H13F3O5 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid |
| SMILES | COc1c(Oc2ccc(OC3CC3)c(F)c2C(=O)O)ccc(F)c1F |
| InChI | InChI=1S/C17H13F3O5/c1-23-16-12(5-4-9(18)14(16)19)25-10-6-7-11(24-8-2-3-8)15(20)13(10)17(21)22/h4-8H,2-3H2,1H3,(H,21,22) |
| InChIKey | WDFBXOWIMVCSHK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid?
The IUPAC name of 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid (CID 154645221) is 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid.
What is the SMILES notation for 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid?
The canonical SMILES for 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid is COc1c(Oc2ccc(OC3CC3)c(F)c2C(=O)O)ccc(F)c1F.
What is the InChIKey of 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid?
The InChIKey is WDFBXOWIMVCSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3O5/c1-23-16-12(5-4-9(18)14(16)19)25-10-6-7-11(24-8-2-3-8)15(20)13(10)17(21)22/h4-8H,2-3H2,1H3,(H,21,22).
What are the key properties of 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid?
3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid has a molecular weight of 354.28 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-6-(3,4-difluoro-2-methoxyphenoxy)-2-fluorobenzoic acid is sourced from PubChem (CID 154645221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).