About cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate
cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate (PubChem CID 154645899) has the molecular formula C13H14BrN3O2
and a molecular weight of 324.18 g/mol. Its IUPAC name is cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate |
| PubChem CID | 154645899 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate |
| SMILES | O=C(OC1CCCCC1)n1cnc2ncc(Br)cc21 |
| InChI | InChI=1S/C13H14BrN3O2/c14-9-6-11-12(15-7-9)16-8-17(11)13(18)19-10-4-2-1-3-5-10/h6-8,10H,1-5H2 |
| InChIKey | NGHMKQGPNQEDJI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate?
The IUPAC name of cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate (CID 154645899) is cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate.
What is the SMILES notation for cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate?
The canonical SMILES for cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate is O=C(OC1CCCCC1)n1cnc2ncc(Br)cc21.
What is the InChIKey of cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate?
The InChIKey is NGHMKQGPNQEDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3O2/c14-9-6-11-12(15-7-9)16-8-17(11)13(18)19-10-4-2-1-3-5-10/h6-8,10H,1-5H2.
What are the key properties of cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate?
cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate has a molecular weight of 324.18 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 6-bromoimidazo[4,5-b]pyridine-1-carboxylate is sourced from PubChem (CID 154645899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).