C21H16Cl3N5O2 — CID 154648289
ethyl 2-[[9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)purin-6-yl]amino]acetate (PubChem CID 154648289) has the molecular formula C21H16Cl3N5O2 and a molecular weight of 476.75 g/mol. Its IUPAC name is ethyl 2-[[9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)purin-6-yl]amino]acetate.
| Compound Name | ethyl 2-[[9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)purin-6-yl]amino]acetate |
|---|---|
| PubChem CID | 154648289 |
| Molecular Formula | C21H16Cl3N5O2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | ethyl 2-[[9-(4-chlorophenyl)-8-(2,4-dichlorophenyl)purin-6-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1ncnc2c1nc(-c1ccc(Cl)cc1Cl)n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl3N5O2/c1-2-31-17(30)10-25-19-18-21(27-11-26-19)29(14-6-3-12(22)4-7-14)20(28-18)15-8-5-13(23)9-16(15)24/h3-9,11H,2,10H2,1H3,(H,25,26,27) |
| InChIKey | ZCPKLTUHBBATIG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |