C18H28ClF3N4OSi — CID 154648529
N-[6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 154648529) has the molecular formula C18H28ClF3N4OSi and a molecular weight of 436.98 g/mol. Its IUPAC name is N-[6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 154648529 |
| Molecular Formula | C18H28ClF3N4OSi |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1cc(Cl)nc2c1c(C(F)(F)F)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H28ClF3N4OSi/c1-25(2)7-6-23-14-10-15(19)24-17-16(14)13(18(20,21)22)11-26(17)12-27-8-9-28(3,4)5/h10-11H,6-9,12H2,1-5H3,(H,23,24) |
| InChIKey | SPGNWJFIUWHDCZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|