C20H23N6O2P — CID 154648713
4-(cyclobutylamino)-2-(4-dimethylphosphoryl-2-methoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 154648713) has the molecular formula C20H23N6O2P and a molecular weight of 410.42 g/mol. Its IUPAC name is 4-(cyclobutylamino)-2-(4-dimethylphosphoryl-2-methoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-(cyclobutylamino)-2-(4-dimethylphosphoryl-2-methoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 154648713 |
| Molecular Formula | C20H23N6O2P |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-(cyclobutylamino)-2-(4-dimethylphosphoryl-2-methoxyanilino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | COc1cc(P(C)(C)=O)ccc1Nc1nc(NC2CCC2)c2c(C#N)c[nH]c2n1 |
| InChI | InChI=1S/C20H23N6O2P/c1-28-16-9-14(29(2,3)27)7-8-15(16)24-20-25-18-17(12(10-21)11-22-18)19(26-20)23-13-5-4-6-13/h7-9,11,13H,4-6H2,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | CLVALYJSJXQWCF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|