C15H24N2O5S — CID 154649102
(NE,R)-2-methyl-N-[2-[3-[2-(1,2-oxazol-3-yl)-1,3-dioxolan-2-yl]propoxy]ethylidene]propane-2-sulfinamide (PubChem CID 154649102) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[2-[3-[2-(1,2-oxazol-3-yl)-1,3-dioxolan-2-yl]propoxy]ethylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[2-[3-[2-(1,2-oxazol-3-yl)-1,3-dioxolan-2-yl]propoxy]ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 154649102 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (NE,R)-2-methyl-N-[2-[3-[2-(1,2-oxazol-3-yl)-1,3-dioxolan-2-yl]propoxy]ethylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/COCCCC1(c2ccon2)OCCO1 |
| InChI | InChI=1S/C15H24N2O5S/c1-14(2,3)23(18)16-7-10-19-8-4-6-15(20-11-12-21-15)13-5-9-22-17-13/h5,7,9H,4,6,8,10-12H2,1-3H3/b16-7+/t23-/m1/s1 |
| InChIKey | WSAQYUDXVSMBHI-GBXRJUDBSA-N |
| XLogP | 2.20 |
| TPSA | 83.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|