About 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine
5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine (PubChem CID 154649246) has the molecular formula C16H17FN6O
and a molecular weight of 328.35 g/mol. Its IUPAC name is 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine |
| PubChem CID | 154649246 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine |
| SMILES | Nc1nc(N2CCCOCC2)c2c(F)cc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C16H17FN6O/c17-11-8-10(12-2-3-19-22-12)9-13-14(11)15(21-16(18)20-13)23-4-1-6-24-7-5-23/h2-3,8-9H,1,4-7H2,(H,19,22)(H2,18,20,21) |
| InChIKey | AQECKOXRSGYRKJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine?
The IUPAC name of 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine (CID 154649246) is 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine.
What is the SMILES notation for 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine?
The canonical SMILES for 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine is Nc1nc(N2CCCOCC2)c2c(F)cc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine?
The InChIKey is AQECKOXRSGYRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN6O/c17-11-8-10(12-2-3-19-22-12)9-13-14(11)15(21-16(18)20-13)23-4-1-6-24-7-5-23/h2-3,8-9H,1,4-7H2,(H,19,22)(H2,18,20,21).
What are the key properties of 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine?
5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine has a molecular weight of 328.35 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-(1,4-oxazepan-4-yl)-7-(1H-pyrazol-5-yl)quinazolin-2-amine is sourced from PubChem (CID 154649246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).