About 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol
3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol (PubChem CID 154649281) has the molecular formula C14H14F2N6O
and a molecular weight of 320.30 g/mol. Its IUPAC name is 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 154649281 |
| Molecular Formula | C14H14F2N6O |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1nc(NCC(F)(F)CO)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C14H14F2N6O/c15-14(16,7-23)6-18-12-9-2-1-8(10-3-4-19-22-10)5-11(9)20-13(17)21-12/h1-5,23H,6-7H2,(H,19,22)(H3,17,18,20,21) |
| InChIKey | AYKSQBFJZAYLPA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol (CID 154649281) is 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol is Nc1nc(NCC(F)(F)CO)c2ccc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol?
The InChIKey is AYKSQBFJZAYLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N6O/c15-14(16,7-23)6-18-12-9-2-1-8(10-3-4-19-22-10)5-11(9)20-13(17)21-12/h1-5,23H,6-7H2,(H,19,22)(H3,17,18,20,21).
What are the key properties of 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol?
3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol has a molecular weight of 320.30 g/mol, XLogP of 1.64, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 154649281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).