About 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine
4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine (PubChem CID 154649342) has the molecular formula C14H11N7O
and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| PubChem CID | 154649342 |
| Molecular Formula | C14H11N7O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(Nc2cnoc2)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C14H11N7O/c15-14-19-12-5-8(11-3-4-16-21-11)1-2-10(12)13(20-14)18-9-6-17-22-7-9/h1-7H,(H,16,21)(H3,15,18,19,20) |
| InChIKey | KMFOCOXNWQMMHY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine?
The IUPAC name of 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine (CID 154649342) is 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine.
What is the SMILES notation for 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine?
The canonical SMILES for 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine is Nc1nc(Nc2cnoc2)c2ccc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine?
The InChIKey is KMFOCOXNWQMMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N7O/c15-14-19-12-5-8(11-3-4-16-21-11)1-2-10(12)13(20-14)18-9-6-17-22-7-9/h1-7H,(H,16,21)(H3,15,18,19,20).
What are the key properties of 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine?
4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine has a molecular weight of 293.29 g/mol, XLogP of 2.33, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(1,2-oxazol-4-yl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine is sourced from PubChem (CID 154649342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).