C20H28N7O2Y- — CID 154650558
1-[4-[(6-amino-3-azabicyclo[3.1.0]hexan-3-yl)methyl]phenyl]-4-(hydroxyamino)pyrimidin-2-one;piperazin-4-ide;yttrium (PubChem CID 154650558) has the molecular formula C20H28N7O2Y- and a molecular weight of 487.40 g/mol. Its IUPAC name is 1-[4-[(6-amino-3-azabicyclo[3.1.0]hexan-3-yl)methyl]phenyl]-4-(hydroxyamino)pyrimidin-2-one;piperazin-4-ide;yttrium.
| Compound Name | 1-[4-[(6-amino-3-azabicyclo[3.1.0]hexan-3-yl)methyl]phenyl]-4-(hydroxyamino)pyrimidin-2-one;piperazin-4-ide;yttrium |
|---|---|
| PubChem CID | 154650558 |
| Molecular Formula | C20H28N7O2Y- |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-[4-[(6-amino-3-azabicyclo[3.1.0]hexan-3-yl)methyl]phenyl]-4-(hydroxyamino)pyrimidin-2-one;piperazin-4-ide;yttrium |
| SMILES | C1CNCC[N-]1.NC1C2CN(Cc3ccc(-n4ccc(NO)nc4=O)cc3)CC12.[Y] |
| InChI | InChI=1S/C16H19N5O2.C4H9N2.Y/c17-15-12-8-20(9-13(12)15)7-10-1-3-11(4-2-10)21-6-5-14(19-23)18-16(21)22;1-2-6-4-3-5-1;/h1-6,12-13,15,23H,7-9,17H2,(H,18,19,22);5H,1-4H2;/q;-1; |
| InChIKey | QZGOQLALYRQSHO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|