C22H27N5O4 — CID 154650642
4-(2-amino-2-methylpropanoyl)-N-[2-oxo-1-[3-(2-oxoethyl)phenyl]-4-pyridinyl]piperazine-1-carboxamide (PubChem CID 154650642) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-(2-amino-2-methylpropanoyl)-N-[2-oxo-1-[3-(2-oxoethyl)phenyl]-4-pyridinyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-amino-2-methylpropanoyl)-N-[2-oxo-1-[3-(2-oxoethyl)phenyl]-4-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154650642 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-(2-amino-2-methylpropanoyl)-N-[2-oxo-1-[3-(2-oxoethyl)phenyl]-4-pyridinyl]piperazine-1-carboxamide |
| SMILES | CC(C)(N)C(=O)N1CCN(C(=O)Nc2ccn(-c3cccc(CC=O)c3)c(=O)c2)CC1 |
| InChI | InChI=1S/C22H27N5O4/c1-22(2,23)20(30)25-9-11-26(12-10-25)21(31)24-17-6-8-27(19(29)15-17)18-5-3-4-16(14-18)7-13-28/h3-6,8,13-15H,7,9-12,23H2,1-2H3,(H,24,31) |
| InChIKey | YEAUPSQEIKCQNQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|