C28H41N7O2S — CID 154650660
1-[4-[2-(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)butyl]phenyl]-4-[4-(2-amino-2-sulfanylpropanoyl)piperazin-1-yl]pyrimidin-2-one (PubChem CID 154650660) has the molecular formula C28H41N7O2S and a molecular weight of 539.75 g/mol. Its IUPAC name is 1-[4-[2-(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)butyl]phenyl]-4-[4-(2-amino-2-sulfanylpropanoyl)piperazin-1-yl]pyrimidin-2-one.
| Compound Name | 1-[4-[2-(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)butyl]phenyl]-4-[4-(2-amino-2-sulfanylpropanoyl)piperazin-1-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 154650660 |
| Molecular Formula | C28H41N7O2S |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 1-[4-[2-(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)butyl]phenyl]-4-[4-(2-amino-2-sulfanylpropanoyl)piperazin-1-yl]pyrimidin-2-one |
| SMILES | CCC(Cc1ccc(-n2ccc(N3CCN(C(=O)C(C)(N)S)CC3)nc2=O)cc1)N1CC2CCC(N)C2C1 |
| InChI | InChI=1S/C28H41N7O2S/c1-3-21(34-17-20-6-9-24(29)23(20)18-34)16-19-4-7-22(8-5-19)35-11-10-25(31-27(35)37)32-12-14-33(15-13-32)26(36)28(2,30)38/h4-5,7-8,10-11,20-21,23-24,38H,3,6,9,12-18,29-30H2,1-2H3 |
| InChIKey | XCUKEZXJTWEPDD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|