C18H25N5O — CID 154651541
4-amino-1-[4-[[[(1S)-3-aminocyclopentyl]-ethylamino]methyl]phenyl]pyrimidin-2-one (PubChem CID 154651541) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-amino-1-[4-[[[(1S)-3-aminocyclopentyl]-ethylamino]methyl]phenyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[4-[[[(1S)-3-aminocyclopentyl]-ethylamino]methyl]phenyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 154651541 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-amino-1-[4-[[[(1S)-3-aminocyclopentyl]-ethylamino]methyl]phenyl]pyrimidin-2-one |
| SMILES | CCN(Cc1ccc(-n2ccc(N)nc2=O)cc1)[C@H]1CCC(N)C1 |
| InChI | InChI=1S/C18H25N5O/c1-2-22(16-8-5-14(19)11-16)12-13-3-6-15(7-4-13)23-10-9-17(20)21-18(23)24/h3-4,6-7,9-10,14,16H,2,5,8,11-12,19H2,1H3,(H2,20,21,24)/t14?,16-/m0/s1 |
| InChIKey | CLTWUQYSPHXPLC-WMCAAGNKSA-N |
| XLogP | 1.52 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |