C23H31N7O2 — CID 154651626
(3aS,6aR)-N-[1-[4-[(4-aminopiperidin-1-yl)methyl]phenyl]-2-oxopyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 154651626) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is (3aS,6aR)-N-[1-[4-[(4-aminopiperidin-1-yl)methyl]phenyl]-2-oxopyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-[1-[4-[(4-aminopiperidin-1-yl)methyl]phenyl]-2-oxopyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 154651626 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (3aS,6aR)-N-[1-[4-[(4-aminopiperidin-1-yl)methyl]phenyl]-2-oxopyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | NC1CCN(Cc2ccc(-n3ccc(NC(=O)N4C[C@H]5CNC[C@H]5C4)nc3=O)cc2)CC1 |
| InChI | InChI=1S/C23H31N7O2/c24-19-5-8-28(9-6-19)13-16-1-3-20(4-2-16)30-10-7-21(27-23(30)32)26-22(31)29-14-17-11-25-12-18(17)15-29/h1-4,7,10,17-19,25H,5-6,8-9,11-15,24H2,(H,26,27,31,32)/t17-,18+ |
| InChIKey | IZEYKCYQHJNFSA-HDICACEKSA-N |
| XLogP | 0.84 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |