C23H35N7O2 — CID 154652398
1-[4-[2-(4-aminoazepan-1-yl)ethyl]phenyl]-4-piperazin-1-ylpyrimidin-2-one;formamide (PubChem CID 154652398) has the molecular formula C23H35N7O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[4-[2-(4-aminoazepan-1-yl)ethyl]phenyl]-4-piperazin-1-ylpyrimidin-2-one;formamide.
| Compound Name | 1-[4-[2-(4-aminoazepan-1-yl)ethyl]phenyl]-4-piperazin-1-ylpyrimidin-2-one;formamide |
|---|---|
| PubChem CID | 154652398 |
| Molecular Formula | C23H35N7O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 1-[4-[2-(4-aminoazepan-1-yl)ethyl]phenyl]-4-piperazin-1-ylpyrimidin-2-one;formamide |
| SMILES | NC1CCCN(CCc2ccc(-n3ccc(N4CCNCC4)nc3=O)cc2)CC1.NC=O |
| InChI | InChI=1S/C22H32N6O.CH3NO/c23-19-2-1-12-26(14-8-19)13-7-18-3-5-20(6-4-18)28-15-9-21(25-22(28)29)27-16-10-24-11-17-27;2-1-3/h3-6,9,15,19,24H,1-2,7-8,10-14,16-17,23H2;1H,(H2,2,3) |
| InChIKey | LWJCWXFLVYPCMV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|