C21H29N5O3 — CID 154652494
tert-butyl N-[1-[[4-(4-amino-2-oxopyrimidin-1-yl)phenyl]methyl]piperidin-4-yl]carbamate (PubChem CID 154652494) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-(4-amino-2-oxopyrimidin-1-yl)phenyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[4-(4-amino-2-oxopyrimidin-1-yl)phenyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154652494 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | tert-butyl N-[1-[[4-(4-amino-2-oxopyrimidin-1-yl)phenyl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2ccc(-n3ccc(N)nc3=O)cc2)CC1 |
| InChI | InChI=1S/C21H29N5O3/c1-21(2,3)29-20(28)23-16-8-11-25(12-9-16)14-15-4-6-17(7-5-15)26-13-10-18(22)24-19(26)27/h4-7,10,13,16H,8-9,11-12,14H2,1-3H3,(H,23,28)(H2,22,24,27) |
| InChIKey | OWNFWCOPYYXKDA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |