C22H27Cl2N5O2 — CID 154653007
1-[5-[(2,6-dichlorophenyl)methoxy]-1-(4,4-dihydrazinylbutyl)indol-3-yl]propan-1-one (PubChem CID 154653007) has the molecular formula C22H27Cl2N5O2 and a molecular weight of 464.40 g/mol. Its IUPAC name is 1-[5-[(2,6-dichlorophenyl)methoxy]-1-(4,4-dihydrazinylbutyl)indol-3-yl]propan-1-one.
| Compound Name | 1-[5-[(2,6-dichlorophenyl)methoxy]-1-(4,4-dihydrazinylbutyl)indol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 154653007 |
| Molecular Formula | C22H27Cl2N5O2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1-[5-[(2,6-dichlorophenyl)methoxy]-1-(4,4-dihydrazinylbutyl)indol-3-yl]propan-1-one |
| SMILES | CCC(=O)c1cn(CCCC(NN)NN)c2ccc(OCc3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C22H27Cl2N5O2/c1-2-21(30)16-12-29(10-4-7-22(27-25)28-26)20-9-8-14(11-15(16)20)31-13-17-18(23)5-3-6-19(17)24/h3,5-6,8-9,11-12,22,27-28H,2,4,7,10,13,25-26H2,1H3 |
| InChIKey | MFQWXDQTVLZQGX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|