About US11248001, Example 36
US11248001, Example 36 (PubChem CID 154653444) has the molecular formula C20H24N10OS2
and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[[(2S)-2-methyl-3-[(5-methylsulfanylpyrimidin-2-yl)amino]propyl]amino]-N-[(2-methyltetrazol-5-yl)methyl]-1,3-benzothiazole-6-carboxamide.
Molecular Properties
| Compound Name | US11248001, Example 36 |
| PubChem CID | 154653444 |
| Molecular Formula | C20H24N10OS2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[[(2S)-2-methyl-3-[(5-methylsulfanylpyrimidin-2-yl)amino]propyl]amino]-N-[(2-methyltetrazol-5-yl)methyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | C[C@@H](CNC1=NC=C(C=N1)SC)CNC2=NC3=C(S2)C=C(C=C3)C(=O)NCC4=NN(N=N4)C |
| InChI | InChI=1S/C20H24N10OS2/c1-12(7-22-19-23-9-14(32-3)10-24-19)8-25-20-26-15-5-4-13(6-16(15)33-20)18(31)21-11-17-27-29-30(2)28-17/h4-6,9-10,12H,7-8,11H2,1-3H3,(H,21,31)(H,25,26)(H,22,23,24)/t12-/m0/s1 |
| InChIKey | KHUPMBDAHFDAOD-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | 626 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze US11248001, Example 36 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US11248001, Example 36?
The IUPAC name of US11248001, Example 36 (CID 154653444) is 2-[[(2S)-2-methyl-3-[(5-methylsulfanylpyrimidin-2-yl)amino]propyl]amino]-N-[(2-methyltetrazol-5-yl)methyl]-1,3-benzothiazole-6-carboxamide.
What is the SMILES notation for US11248001, Example 36?
The canonical SMILES for US11248001, Example 36 is C[C@@H](CNC1=NC=C(C=N1)SC)CNC2=NC3=C(S2)C=C(C=C3)C(=O)NCC4=NN(N=N4)C.
What is the InChIKey of US11248001, Example 36?
The InChIKey is KHUPMBDAHFDAOD-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H24N10OS2/c1-12(7-22-19-23-9-14(32-3)10-24-19)8-25-20-26-15-5-4-13(6-16(15)33-20)18(31)21-11-17-27-29-30(2)28-17/h4-6,9-10,12H,7-8,11H2,1-3H3,(H,21,31)(H,25,26)(H,22,23,24)/t12-/m0/s1.
What are the key properties of US11248001, Example 36?
US11248001, Example 36 has a molecular weight of 484.60 g/mol, XLogP of 3.30, 10 rotatable bonds, 3 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for US11248001, Example 36 is sourced from PubChem (CID 154653444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).